C27H34N2O7S — CID 152906999
tert-butyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)hexanoate (PubChem CID 152906999) has the molecular formula C27H34N2O7S and a molecular weight of 530.64 g/mol. Its IUPAC name is tert-butyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)hexanoate.
| Compound Name | tert-butyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)hexanoate |
|---|---|
| PubChem CID | 152906999 |
| Molecular Formula | C27H34N2O7S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | tert-butyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-ylmethyl)hexanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)C[C@@H](Cc1ccc2c(c1)CCCC2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34N2O7S/c1-18(28-37(34,35)25-12-8-7-11-23(25)29(32)33)24(30)17-22(26(31)36-27(2,3)4)16-19-13-14-20-9-5-6-10-21(20)15-19/h7-8,11-15,18,22,28H,5-6,9-10,16-17H2,1-4H3/t18-,22+/m0/s1 |
| InChIKey | UGLGNUZTIBTWSN-PGRDOPGGSA-N |
| XLogP | 4.30 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|