C21H21F3N2O7S — CID 152873513
methyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]hexanoate (PubChem CID 152873513) has the molecular formula C21H21F3N2O7S and a molecular weight of 502.47 g/mol. Its IUPAC name is methyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]hexanoate.
| Compound Name | methyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 152873513 |
| Molecular Formula | C21H21F3N2O7S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl (2R,5S)-5-[(2-nitrophenyl)sulfonylamino]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]hexanoate |
| SMILES | COC(=O)[C@@H](CC(=O)[C@H](C)NS(=O)(=O)c1ccccc1[N+](=O)[O-])Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N2O7S/c1-13(25-34(31,32)19-6-4-3-5-17(19)26(29)30)18(27)12-15(20(28)33-2)11-14-7-9-16(10-8-14)21(22,23)24/h3-10,13,15,25H,11-12H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | TZWHVXHRCWOEQC-DZGCQCFKSA-N |
| XLogP | 3.27 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|