C25H32N2O7S — CID 161211928
tert-butyl (2R,5S)-2-[(3,4-dimethylphenyl)methyl]-5-[(2-nitrophenyl)sulfonylamino]-4-oxohexanoate (PubChem CID 161211928) has the molecular formula C25H32N2O7S and a molecular weight of 504.61 g/mol. Its IUPAC name is tert-butyl (2R,5S)-2-[(3,4-dimethylphenyl)methyl]-5-[(2-nitrophenyl)sulfonylamino]-4-oxohexanoate.
| Compound Name | tert-butyl (2R,5S)-2-[(3,4-dimethylphenyl)methyl]-5-[(2-nitrophenyl)sulfonylamino]-4-oxohexanoate |
|---|---|
| PubChem CID | 161211928 |
| Molecular Formula | C25H32N2O7S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | tert-butyl (2R,5S)-2-[(3,4-dimethylphenyl)methyl]-5-[(2-nitrophenyl)sulfonylamino]-4-oxohexanoate |
| SMILES | Cc1ccc(C[C@H](CC(=O)[C@H](C)NS(=O)(=O)c2ccccc2[N+](=O)[O-])C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C25H32N2O7S/c1-16-11-12-19(13-17(16)2)14-20(24(29)34-25(4,5)6)15-22(28)18(3)26-35(32,33)23-10-8-7-9-21(23)27(30)31/h7-13,18,20,26H,14-15H2,1-6H3/t18-,20+/m0/s1 |
| InChIKey | UWISMWXDZMXCAR-AZUAARDMSA-N |
| XLogP | 4.04 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|