C23H27F2N3O7S — CID 138660314
tert-butyl (2S)-3-(2,6-difluoro-4-methylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate (PubChem CID 138660314) has the molecular formula C23H27F2N3O7S and a molecular weight of 527.55 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2,6-difluoro-4-methylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-3-(2,6-difluoro-4-methylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 138660314 |
| Molecular Formula | C23H27F2N3O7S |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | tert-butyl (2S)-3-(2,6-difluoro-4-methylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate |
| SMILES | Cc1cc(F)c(C[C@H](NC(=O)[C@H](C)NS(=O)(=O)c2ccccc2[N+](=O)[O-])C(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C23H27F2N3O7S/c1-13-10-16(24)15(17(25)11-13)12-18(22(30)35-23(3,4)5)26-21(29)14(2)27-36(33,34)20-9-7-6-8-19(20)28(31)32/h6-11,14,18,27H,12H2,1-5H3,(H,26,29)/t14-,18-/m0/s1 |
| InChIKey | AXWHPOHXJRYFTO-KSSFIOAISA-N |
| XLogP | 2.92 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|