C26H34FN3O6S — CID 126559750
tert-butyl (2S)-3-(2-fluoro-4,6-dimethylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate (PubChem CID 126559750) has the molecular formula C26H34FN3O6S and a molecular weight of 535.64 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2-fluoro-4,6-dimethylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate.
| Compound Name | tert-butyl (2S)-3-(2-fluoro-4,6-dimethylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 126559750 |
| Molecular Formula | C26H34FN3O6S |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | tert-butyl (2S)-3-(2-fluoro-4,6-dimethylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
| SMILES | Cc1cc(C)c(C[C@@H](C(=O)OC(C)(C)C)N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])[C@@H](C)C2)c(F)c1 |
| InChI | InChI=1S/C26H34FN3O6S/c1-17-13-18(2)20(21(27)14-17)15-23(25(31)36-26(4,5)6)28-11-12-29(19(3)16-28)37(34,35)24-10-8-7-9-22(24)30(32)33/h7-10,13-14,19,23H,11-12,15-16H2,1-6H3/t19-,23-/m0/s1 |
| InChIKey | DEUVYMILCSSZAT-CVDCTZTESA-N |
| XLogP | 4.00 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|