C23H26N4O6S — CID 126560515
methyl (2S)-3-(1H-indol-3-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate (PubChem CID 126560515) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is methyl (2S)-3-(1H-indol-3-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate.
| Compound Name | methyl (2S)-3-(1H-indol-3-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 126560515 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | methyl (2S)-3-(1H-indol-3-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](C)C1 |
| InChI | InChI=1S/C23H26N4O6S/c1-16-15-25(11-12-26(16)34(31,32)22-10-6-5-9-20(22)27(29)30)21(23(28)33-2)13-17-14-24-19-8-4-3-7-18(17)19/h3-10,14,16,21,24H,11-13,15H2,1-2H3/t16-,21-/m0/s1 |
| InChIKey | PFLIMUMWGHXABC-KKSFZXQISA-N |
| XLogP | 2.56 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|