C22H26FN3O6S — CID 126560510
methyl (2S)-3-(2-fluoro-4-methylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate (PubChem CID 126560510) has the molecular formula C22H26FN3O6S and a molecular weight of 479.53 g/mol. Its IUPAC name is methyl (2S)-3-(2-fluoro-4-methylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate.
| Compound Name | methyl (2S)-3-(2-fluoro-4-methylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 126560510 |
| Molecular Formula | C22H26FN3O6S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | methyl (2S)-3-(2-fluoro-4-methylphenyl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(C)cc1F)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](C)C1 |
| InChI | InChI=1S/C22H26FN3O6S/c1-15-8-9-17(18(23)12-15)13-20(22(27)32-3)24-10-11-25(16(2)14-24)33(30,31)21-7-5-4-6-19(21)26(28)29/h4-9,12,16,20H,10-11,13-14H2,1-3H3/t16-,20-/m0/s1 |
| InChIKey | UATZBJJNRHUTDR-JXFKEZNVSA-N |
| XLogP | 2.52 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|