C28H37N3O6S — CID 138659847
tert-butyl (2S)-3-(6-methyl-2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate (PubChem CID 138659847) has the molecular formula C28H37N3O6S and a molecular weight of 543.69 g/mol. Its IUPAC name is tert-butyl (2S)-3-(6-methyl-2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate.
| Compound Name | tert-butyl (2S)-3-(6-methyl-2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 138659847 |
| Molecular Formula | C28H37N3O6S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | tert-butyl (2S)-3-(6-methyl-2,3-dihydro-1H-inden-5-yl)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]propanoate |
| SMILES | Cc1cc2c(cc1CC(C(=O)OC(C)(C)C)N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])[C@@H](C)C1)CCC2 |
| InChI | InChI=1S/C28H37N3O6S/c1-19-15-21-9-8-10-22(21)16-23(19)17-25(27(32)37-28(3,4)5)29-13-14-30(20(2)18-29)38(35,36)26-12-7-6-11-24(26)31(33)34/h6-7,11-12,15-16,20,25H,8-10,13-14,17-18H2,1-5H3/t20-,25?/m0/s1 |
| InChIKey | HWEZSTPAGIWBCY-JINQPTGOSA-N |
| XLogP | 4.04 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|