C31H38N4O7S — CID 160609957
tert-butyl N-[2-[(2S)-4-[(2S)-1-naphthalen-2-yl-3-oxobutan-2-yl]-1-(2-nitrophenyl)sulfonylpiperazin-2-yl]ethyl]carbamate (PubChem CID 160609957) has the molecular formula C31H38N4O7S and a molecular weight of 610.73 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-4-[(2S)-1-naphthalen-2-yl-3-oxobutan-2-yl]-1-(2-nitrophenyl)sulfonylpiperazin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S)-4-[(2S)-1-naphthalen-2-yl-3-oxobutan-2-yl]-1-(2-nitrophenyl)sulfonylpiperazin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 160609957 |
| Molecular Formula | C31H38N4O7S |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | tert-butyl N-[2-[(2S)-4-[(2S)-1-naphthalen-2-yl-3-oxobutan-2-yl]-1-(2-nitrophenyl)sulfonylpiperazin-2-yl]ethyl]carbamate |
| SMILES | CC(=O)[C@H](Cc1ccc2ccccc2c1)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](CCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C31H38N4O7S/c1-22(36)28(20-23-13-14-24-9-5-6-10-25(24)19-23)33-17-18-34(26(21-33)15-16-32-30(37)42-31(2,3)4)43(40,41)29-12-8-7-11-27(29)35(38)39/h5-14,19,26,28H,15-18,20-21H2,1-4H3,(H,32,37)/t26-,28-/m0/s1 |
| InChIKey | RFJOQKXNQOZKLQ-XCZPVHLTSA-N |
| XLogP | 4.54 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|