C25H30F3N3O7S — CID 138660279
tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propanoate (PubChem CID 138660279) has the molecular formula C25H30F3N3O7S and a molecular weight of 573.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 138660279 |
| Molecular Formula | C25H30F3N3O7S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]propanoate |
| SMILES | C[C@H]1CN([C@@H](Cc2ccc(OC(F)(F)F)cc2)C(=O)OC(C)(C)C)CCN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H30F3N3O7S/c1-17-16-29(13-14-30(17)39(35,36)22-8-6-5-7-20(22)31(33)34)21(23(32)38-24(2,3)4)15-18-9-11-19(12-10-18)37-25(26,27)28/h5-12,17,21H,13-16H2,1-4H3/t17-,21-/m0/s1 |
| InChIKey | XHENOVTWQDVBDO-UWJYYQICSA-N |
| XLogP | 4.14 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|