C26H35N3O6S — CID 138659849
tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)butanoate (PubChem CID 138659849) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)butanoate.
| Compound Name | tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)butanoate |
|---|---|
| PubChem CID | 138659849 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | tert-butyl (2S)-2-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-3-(4-methylphenyl)butanoate |
| SMILES | Cc1ccc(C(C)[C@@H](C(=O)OC(C)(C)C)N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C26H35N3O6S/c1-18-11-13-21(14-12-18)20(3)24(25(30)35-26(4,5)6)27-15-16-28(19(2)17-27)36(33,34)23-10-8-7-9-22(23)29(31)32/h7-14,19-20,24H,15-17H2,1-6H3/t19-,20?,24-/m0/s1 |
| InChIKey | MDHBIQBAGVZFBC-DHFSANGXSA-N |
| XLogP | 4.11 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|