C36H51N3O7SSi — CID 11549345
tert-butyl N-[4-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-(2-nitrophenyl)sulfonylamino]butyl]carbamate (PubChem CID 11549345) has the molecular formula C36H51N3O7SSi and a molecular weight of 697.97 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-(2-nitrophenyl)sulfonylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-(2-nitrophenyl)sulfonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 11549345 |
| Molecular Formula | C36H51N3O7SSi |
| Molecular Weight | 697.97 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | tert-butyl N-[4-[[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-(2-nitrophenyl)sulfonylamino]butyl]carbamate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccc2ccccc2c1)N(CCCCNC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C36H51N3O7SSi/c1-10-32(46-48(8,9)36(5,6)7)31(26-27-21-22-28-17-11-12-18-29(28)25-27)38(24-16-15-23-37-34(40)45-35(2,3)4)47(43,44)33-20-14-13-19-30(33)39(41)42/h10-14,17-22,25,31-32H,1,15-16,23-24,26H2,2-9H3,(H,37,40)/t31-,32-/m0/s1 |
| InChIKey | DLMXSUNOBLGRLW-ACHIHNKUSA-N |
| XLogP | 8.23 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.97 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|