C27H34N2O5SSi — CID 11562744
N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 11562744) has the molecular formula C27H34N2O5SSi and a molecular weight of 526.73 g/mol. Its IUPAC name is N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 11562744 |
| Molecular Formula | C27H34N2O5SSi |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-2-ylpent-4-en-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccc2ccccc2c1)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H34N2O5SSi/c1-7-25(34-36(5,6)27(2,3)4)23(19-20-16-17-21-12-8-9-13-22(21)18-20)28-35(32,33)26-15-11-10-14-24(26)29(30)31/h7-18,23,25,28H,1,19H2,2-6H3/t23-,25-/m0/s1 |
| InChIKey | WUKZBXGPJKLOKO-ZCYQVOJMSA-N |
| XLogP | 6.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|