C24H34N2O5SSi — CID 102397506
N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-4-en-2-yl]-N-methyl-4-nitrobenzenesulfonamide (PubChem CID 102397506) has the molecular formula C24H34N2O5SSi and a molecular weight of 490.70 g/mol. Its IUPAC name is N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-4-en-2-yl]-N-methyl-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-4-en-2-yl]-N-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 102397506 |
| Molecular Formula | C24H34N2O5SSi |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpent-4-en-2-yl]-N-methyl-4-nitrobenzenesulfonamide |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)N(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H34N2O5SSi/c1-8-23(31-33(6,7)24(2,3)4)22(18-19-12-10-9-11-13-19)25(5)32(29,30)21-16-14-20(15-17-21)26(27)28/h8-17,22-23H,1,18H2,2-7H3/t22-,23-/m0/s1 |
| InChIKey | LQBXBSOMXLETBS-GOTSBHOMSA-N |
| XLogP | 5.40 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|