C22H22N2O6S — CID 11385193
N-[2-(furan-2-yl)ethyl]-4-nitro-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide (PubChem CID 11385193) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-4-nitro-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-4-nitro-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11385193 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-4-nitro-N-(1-phenylmethoxyprop-2-enyl)benzenesulfonamide |
| SMILES | C=CC(OCc1ccccc1)N(CCc1ccco1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-2-22(30-17-18-7-4-3-5-8-18)23(15-14-20-9-6-16-29-20)31(27,28)21-12-10-19(11-13-21)24(25)26/h2-13,16,22H,1,14-15,17H2 |
| InChIKey | PNTWRSSDXIVVEF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|