C29H39N3O6SSi — CID 67112707
1-[(1E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhepta-1,6-dien-4-yl]-4-(4-nitrophenyl)sulfonylpiperazin-2-one (PubChem CID 67112707) has the molecular formula C29H39N3O6SSi and a molecular weight of 585.80 g/mol. Its IUPAC name is 1-[(1E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhepta-1,6-dien-4-yl]-4-(4-nitrophenyl)sulfonylpiperazin-2-one.
| Compound Name | 1-[(1E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhepta-1,6-dien-4-yl]-4-(4-nitrophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 67112707 |
| Molecular Formula | C29H39N3O6SSi |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 1-[(1E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhepta-1,6-dien-4-yl]-4-(4-nitrophenyl)sulfonylpiperazin-2-one |
| SMILES | C=CC[C@H]([C@@H](/C=C/c1ccccc1)O[Si](C)(C)C(C)(C)C)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1=O |
| InChI | InChI=1S/C29H39N3O6SSi/c1-7-11-26(27(38-40(5,6)29(2,3)4)19-14-23-12-9-8-10-13-23)31-21-20-30(22-28(31)33)39(36,37)25-17-15-24(16-18-25)32(34)35/h7-10,12-19,26-27H,1,11,20-22H2,2-6H3/b19-14+/t26-,27-/m1/s1 |
| InChIKey | LVYHXMNWDWUJBK-QIPRZIDWSA-N |
| XLogP | 5.48 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|