C20H27N3O6Si — CID 102173385
methyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-7-(4-nitrophenyl)-3-oxohept-6-enoate (PubChem CID 102173385) has the molecular formula C20H27N3O6Si and a molecular weight of 433.54 g/mol. Its IUPAC name is methyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-7-(4-nitrophenyl)-3-oxohept-6-enoate.
| Compound Name | methyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-7-(4-nitrophenyl)-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 102173385 |
| Molecular Formula | C20H27N3O6Si |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | methyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-7-(4-nitrophenyl)-3-oxohept-6-enoate |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)CC(/C=C/c1ccc([N+](=O)[O-])cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H27N3O6Si/c1-20(2,3)30(5,6)29-16(13-17(24)18(22-21)19(25)28-4)12-9-14-7-10-15(11-8-14)23(26)27/h7-12,16H,13H2,1-6H3/b12-9+ |
| InChIKey | SHISKJSDOHUKMC-FMIVXFBMSA-N |
| XLogP | 3.80 |
| TPSA | 132.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|