C13H17NO3 — CID 171365744
(E,3R)-4,4-dimethyl-1-(4-nitrophenyl)pent-1-en-3-ol (PubChem CID 171365744) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (E,3R)-4,4-dimethyl-1-(4-nitrophenyl)pent-1-en-3-ol.
| Compound Name | (E,3R)-4,4-dimethyl-1-(4-nitrophenyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 171365744 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (E,3R)-4,4-dimethyl-1-(4-nitrophenyl)pent-1-en-3-ol |
| SMILES | CC(C)(C)[C@H](O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17NO3/c1-13(2,3)12(15)9-6-10-4-7-11(8-5-10)14(16)17/h4-9,12,15H,1-3H3/b9-6+/t12-/m1/s1 |
| InChIKey | UBYPYFBYVCHAAM-UVMWJGKXSA-N |
| XLogP | 3.02 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|