C13H13NO4 — CID 72545467
[(1Z)-1-(4-nitrophenyl)penta-1,4-dien-3-yl] acetate (PubChem CID 72545467) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is [(1Z)-1-(4-nitrophenyl)penta-1,4-dien-3-yl] acetate.
| Compound Name | [(1Z)-1-(4-nitrophenyl)penta-1,4-dien-3-yl] acetate |
|---|---|
| PubChem CID | 72545467 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | [(1Z)-1-(4-nitrophenyl)penta-1,4-dien-3-yl] acetate |
| SMILES | C=CC(/C=C\c1ccc([N+](=O)[O-])cc1)OC(C)=O |
| InChI | InChI=1S/C13H13NO4/c1-3-13(18-10(2)15)9-6-11-4-7-12(8-5-11)14(16)17/h3-9,13H,1H2,2H3/b9-6- |
| InChIKey | IAJCEIKMYDFTAN-TWGQIWQCSA-N |
| XLogP | 2.73 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|