About 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone
1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone (PubChem CID 88505164) has the molecular formula C16H14N2O5
and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone.
Molecular Properties
| Compound Name | 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone |
| PubChem CID | 88505164 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone |
| SMILES | C=Cc1ccc([N+](=O)[O-])cc1.CC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H7NO3.C8H7NO2/c1-6(10)7-2-4-8(5-3-7)9(11)12;1-2-7-3-5-8(6-4-7)9(10)11/h2-5H,1H3;2-6H,1H2 |
| InChIKey | PLPYVCWYGIZKKX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone?
The IUPAC name of 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone (CID 88505164) is 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone.
What is the SMILES notation for 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone?
The canonical SMILES for 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone is C=Cc1ccc([N+](=O)[O-])cc1.CC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone?
The InChIKey is PLPYVCWYGIZKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C8H7NO2/c1-6(10)7-2-4-8(5-3-7)9(11)12;1-2-7-3-5-8(6-4-7)9(10)11/h2-5H,1H3;2-6H,1H2.
What are the key properties of 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone?
1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone has a molecular weight of 314.30 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-nitrobenzene;1-(4-nitrophenyl)ethanone is sourced from PubChem (CID 88505164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).