C33H38N2O5Si — CID 101396083
ethyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-diazo-3-oxo-8-phenylmethoxyoct-6-enoate (PubChem CID 101396083) has the molecular formula C33H38N2O5Si and a molecular weight of 570.76 g/mol. Its IUPAC name is ethyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-diazo-3-oxo-8-phenylmethoxyoct-6-enoate.
| Compound Name | ethyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-diazo-3-oxo-8-phenylmethoxyoct-6-enoate |
|---|---|
| PubChem CID | 101396083 |
| Molecular Formula | C33H38N2O5Si |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | ethyl (E,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-diazo-3-oxo-8-phenylmethoxyoct-6-enoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)C[C@@H](/C=C/COCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H38N2O5Si/c1-5-39-32(37)31(35-34)30(36)24-27(18-15-23-38-25-26-16-9-6-10-17-26)40-41(33(2,3)4,28-19-11-7-12-20-28)29-21-13-8-14-22-29/h6-22,27H,5,23-25H2,1-4H3/b18-15+/t27-/m1/s1 |
| InChIKey | KFGDADXZIWRDDS-YIJROUQKSA-N |
| XLogP | 4.90 |
| TPSA | 98.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|