C21H26N2O4 — CID 132558576
ethyl 2-diazo-6,6-dimethyl-3-oxo-10-phenylmethoxydeca-7,8-dienoate (PubChem CID 132558576) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl 2-diazo-6,6-dimethyl-3-oxo-10-phenylmethoxydeca-7,8-dienoate.
| Compound Name | ethyl 2-diazo-6,6-dimethyl-3-oxo-10-phenylmethoxydeca-7,8-dienoate |
|---|---|
| PubChem CID | 132558576 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | ethyl 2-diazo-6,6-dimethyl-3-oxo-10-phenylmethoxydeca-7,8-dienoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)CCC(C)(C)C=C=CCOCc1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c1-4-27-20(25)19(23-22)18(24)12-14-21(2,3)13-8-9-15-26-16-17-10-6-5-7-11-17/h5-7,9-11,13H,4,12,14-16H2,1-3H3 |
| InChIKey | MVJHIZOWMYHGMJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|