C25H35NO3Si — CID 58126646
tert-butyl-dimethyl-[(S)-[(1S,3R)-3-[(4-nitrophenyl)methyl]cyclopentyl]-phenylmethoxy]silane (PubChem CID 58126646) has the molecular formula C25H35NO3Si and a molecular weight of 425.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(S)-[(1S,3R)-3-[(4-nitrophenyl)methyl]cyclopentyl]-phenylmethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(S)-[(1S,3R)-3-[(4-nitrophenyl)methyl]cyclopentyl]-phenylmethoxy]silane |
|---|---|
| PubChem CID | 58126646 |
| Molecular Formula | C25H35NO3Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl-dimethyl-[(S)-[(1S,3R)-3-[(4-nitrophenyl)methyl]cyclopentyl]-phenylmethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1ccccc1)[C@H]1CC[C@@H](Cc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C25H35NO3Si/c1-25(2,3)30(4,5)29-24(21-9-7-6-8-10-21)22-14-11-20(18-22)17-19-12-15-23(16-13-19)26(27)28/h6-10,12-13,15-16,20,22,24H,11,14,17-18H2,1-5H3/t20-,22-,24+/m0/s1 |
| InChIKey | BXFVKDAVLOUMLB-ODGPQVTHSA-N |
| XLogP | 7.32 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|