C24H36N2OSi — CID 158028191
5-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]cyclopentyl]methyl]pyridin-2-amine (PubChem CID 158028191) has the molecular formula C24H36N2OSi and a molecular weight of 396.65 g/mol. Its IUPAC name is 5-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]cyclopentyl]methyl]pyridin-2-amine.
| Compound Name | 5-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]cyclopentyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 158028191 |
| Molecular Formula | C24H36N2OSi |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 5-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]cyclopentyl]methyl]pyridin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1ccccc1)[C@H]1CCC(Cc2ccc(N)nc2)C1 |
| InChI | InChI=1S/C24H36N2OSi/c1-24(2,3)28(4,5)27-23(20-9-7-6-8-10-20)21-13-11-18(16-21)15-19-12-14-22(25)26-17-19/h6-10,12,14,17-18,21,23H,11,13,15-16H2,1-5H3,(H2,25,26)/t18?,21-,23+/m0/s1 |
| InChIKey | FGVWVCDYMFMLFS-DNPUCPKASA-N |
| XLogP | 6.39 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|