C26H35FO3Si — CID 159216210
4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(4-fluorophenyl)methyl]cyclopentyl]methyl]benzoic acid (PubChem CID 159216210) has the molecular formula C26H35FO3Si and a molecular weight of 442.65 g/mol. Its IUPAC name is 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(4-fluorophenyl)methyl]cyclopentyl]methyl]benzoic acid.
| Compound Name | 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(4-fluorophenyl)methyl]cyclopentyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 159216210 |
| Molecular Formula | C26H35FO3Si |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-[[(3S)-3-[(S)-[tert-butyl(dimethyl)silyl]oxy-(4-fluorophenyl)methyl]cyclopentyl]methyl]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1ccc(F)cc1)[C@H]1CCC(Cc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C26H35FO3Si/c1-26(2,3)31(4,5)30-24(20-12-14-23(27)15-13-20)22-11-8-19(17-22)16-18-6-9-21(10-7-18)25(28)29/h6-7,9-10,12-15,19,22,24H,8,11,16-17H2,1-5H3,(H,28,29)/t19?,22-,24+/m0/s1 |
| InChIKey | DRAVHBPSYCVEMQ-DGUFBMEBSA-N |
| XLogP | 7.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|