C24H32ClN3O5Si — CID 89049328
(2R,5S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid (PubChem CID 89049328) has the molecular formula C24H32ClN3O5Si and a molecular weight of 506.08 g/mol. Its IUPAC name is (2R,5S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,5S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 89049328 |
| Molecular Formula | C24H32ClN3O5Si |
| Molecular Weight | 506.08 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (2R,5S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1ccc(Cl)nc1)[C@H]1CC[C@@H](Cc2ccc([N+](=O)[O-])cc2)N1C(=O)O |
| InChI | InChI=1S/C24H32ClN3O5Si/c1-24(2,3)34(4,5)33-22(17-8-13-21(25)26-15-17)20-12-11-19(27(20)23(29)30)14-16-6-9-18(10-7-16)28(31)32/h6-10,13,15,19-20,22H,11-12,14H2,1-5H3,(H,29,30)/t19-,20+,22+/m0/s1 |
| InChIKey | GMBDMLSNJHAXPK-TUNNFDKTSA-N |
| XLogP | 6.46 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.08 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|