C16H23FO2Si — CID 44556375
(2S)-2-[(R)-(4-fluorophenyl)-trimethylsilyloxymethyl]cyclohexan-1-one (PubChem CID 44556375) has the molecular formula C16H23FO2Si and a molecular weight of 294.44 g/mol. Its IUPAC name is (2S)-2-[(R)-(4-fluorophenyl)-trimethylsilyloxymethyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(R)-(4-fluorophenyl)-trimethylsilyloxymethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 44556375 |
| Molecular Formula | C16H23FO2Si |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2S)-2-[(R)-(4-fluorophenyl)-trimethylsilyloxymethyl]cyclohexan-1-one |
| SMILES | C[Si](C)(C)O[C@@H](c1ccc(F)cc1)[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C16H23FO2Si/c1-20(2,3)19-16(12-8-10-13(17)11-9-12)14-6-4-5-7-15(14)18/h8-11,14,16H,4-7H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | WPGJRHIUWDUDOK-ZBFHGGJFSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|