C27H38O7Si2 — CID 15164067
3,5-bis[(4-methoxyphenyl)-trimethylsilyloxymethyl]oxane-2,6-dione (PubChem CID 15164067) has the molecular formula C27H38O7Si2 and a molecular weight of 530.77 g/mol. Its IUPAC name is 3,5-bis[(4-methoxyphenyl)-trimethylsilyloxymethyl]oxane-2,6-dione.
| Compound Name | 3,5-bis[(4-methoxyphenyl)-trimethylsilyloxymethyl]oxane-2,6-dione |
|---|---|
| PubChem CID | 15164067 |
| Molecular Formula | C27H38O7Si2 |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 3,5-bis[(4-methoxyphenyl)-trimethylsilyloxymethyl]oxane-2,6-dione |
| SMILES | COc1ccc(C(O[Si](C)(C)C)C2CC(C(O[Si](C)(C)C)c3ccc(OC)cc3)C(=O)OC2=O)cc1 |
| InChI | InChI=1S/C27H38O7Si2/c1-30-20-13-9-18(10-14-20)24(33-35(3,4)5)22-17-23(27(29)32-26(22)28)25(34-36(6,7)8)19-11-15-21(31-2)16-12-19/h9-16,22-25H,17H2,1-8H3 |
| InChIKey | SZQCEEMYPCAVIF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|