C18H24O6Si — CID 101449757
dimethyl 2-[(4-methoxyphenyl)-trimethylsilyloxymethyl]cycloprop-2-ene-1,1-dicarboxylate (PubChem CID 101449757) has the molecular formula C18H24O6Si and a molecular weight of 364.47 g/mol. Its IUPAC name is dimethyl 2-[(4-methoxyphenyl)-trimethylsilyloxymethyl]cycloprop-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[(4-methoxyphenyl)-trimethylsilyloxymethyl]cycloprop-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101449757 |
| Molecular Formula | C18H24O6Si |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | dimethyl 2-[(4-methoxyphenyl)-trimethylsilyloxymethyl]cycloprop-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C1C(O[Si](C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24O6Si/c1-21-13-9-7-12(8-10-13)15(24-25(4,5)6)14-11-18(14,16(19)22-2)17(20)23-3/h7-11,15H,1-6H3 |
| InChIKey | LKGTURALAZHHJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|