C23H36O4Si — CID 101131254
ethyl 2-[(1R,2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-oxocyclohexyl]acetate (PubChem CID 101131254) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is ethyl 2-[(1R,2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-oxocyclohexyl]acetate.
| Compound Name | ethyl 2-[(1R,2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-oxocyclohexyl]acetate |
|---|---|
| PubChem CID | 101131254 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | ethyl 2-[(1R,2S)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-oxocyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCCC(=O)[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H36O4Si/c1-7-26-20(25)16-18-14-11-15-19(24)21(18)22(17-12-9-8-10-13-17)27-28(5,6)23(2,3)4/h8-10,12-13,18,21-22H,7,11,14-16H2,1-6H3/t18-,21-,22-/m1/s1 |
| InChIKey | MRDCRKWWDUGYDP-STZQEDGTSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|