C16H22O4 — CID 146603555
ethyl 2-[3-hydroxy-2-[hydroxy(phenyl)methyl]cyclopentyl]acetate (PubChem CID 146603555) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-2-[hydroxy(phenyl)methyl]cyclopentyl]acetate.
| Compound Name | ethyl 2-[3-hydroxy-2-[hydroxy(phenyl)methyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 146603555 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl 2-[3-hydroxy-2-[hydroxy(phenyl)methyl]cyclopentyl]acetate |
| SMILES | CCOC(=O)CC1CCC(O)C1C(O)c1ccccc1 |
| InChI | InChI=1S/C16H22O4/c1-2-20-14(18)10-12-8-9-13(17)15(12)16(19)11-6-4-3-5-7-11/h3-7,12-13,15-17,19H,2,8-10H2,1H3 |
| InChIKey | QVYNUWVWYHUHQH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |