C18H26O3 — CID 146603550
ethyl 2-[3-hydroxy-2-(3-phenylpropyl)cyclopentyl]acetate (PubChem CID 146603550) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-2-(3-phenylpropyl)cyclopentyl]acetate.
| Compound Name | ethyl 2-[3-hydroxy-2-(3-phenylpropyl)cyclopentyl]acetate |
|---|---|
| PubChem CID | 146603550 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | ethyl 2-[3-hydroxy-2-(3-phenylpropyl)cyclopentyl]acetate |
| SMILES | CCOC(=O)CC1CCC(O)C1CCCc1ccccc1 |
| InChI | InChI=1S/C18H26O3/c1-2-21-18(20)13-15-11-12-17(19)16(15)10-6-9-14-7-4-3-5-8-14/h3-5,7-8,15-17,19H,2,6,9-13H2,1H3 |
| InChIKey | AYKUVCNJEOCDSB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |