C19H21NO4 — CID 124828312
(2R,4S)-4-[(4-nitrophenyl)methyl]-2-[(1S)-1-phenylethoxy]oxolane (PubChem CID 124828312) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,4S)-4-[(4-nitrophenyl)methyl]-2-[(1S)-1-phenylethoxy]oxolane.
| Compound Name | (2R,4S)-4-[(4-nitrophenyl)methyl]-2-[(1S)-1-phenylethoxy]oxolane |
|---|---|
| PubChem CID | 124828312 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2R,4S)-4-[(4-nitrophenyl)methyl]-2-[(1S)-1-phenylethoxy]oxolane |
| SMILES | C[C@H](O[C@@H]1C[C@H](Cc2ccc([N+](=O)[O-])cc2)CO1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c1-14(17-5-3-2-4-6-17)24-19-12-16(13-23-19)11-15-7-9-18(10-8-15)20(21)22/h2-10,14,16,19H,11-13H2,1H3/t14-,16-,19+/m0/s1 |
| InChIKey | JMGJVBYWFITZOE-URLQWDBASA-N |
| XLogP | 4.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|