C24H31N3O7S — CID 126559293
tert-butyl (2S)-3-(3,4-dimethylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate (PubChem CID 126559293) has the molecular formula C24H31N3O7S and a molecular weight of 505.59 g/mol. Its IUPAC name is tert-butyl (2S)-3-(3,4-dimethylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-3-(3,4-dimethylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 126559293 |
| Molecular Formula | C24H31N3O7S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | tert-butyl (2S)-3-(3,4-dimethylphenyl)-2-[[(2S)-2-[(2-nitrophenyl)sulfonylamino]propanoyl]amino]propanoate |
| SMILES | Cc1ccc(C[C@H](NC(=O)[C@H](C)NS(=O)(=O)c2ccccc2[N+](=O)[O-])C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C24H31N3O7S/c1-15-11-12-18(13-16(15)2)14-19(23(29)34-24(4,5)6)25-22(28)17(3)26-35(32,33)21-10-8-7-9-20(21)27(30)31/h7-13,17,19,26H,14H2,1-6H3,(H,25,28)/t17-,19-/m0/s1 |
| InChIKey | RMOZLGNYCXJIEB-HKUYNNGSSA-N |
| XLogP | 2.95 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|