C21H26N2O7S — CID 177407152
methyl (2S)-2-[methyl-(2-nitrophenyl)sulfonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 177407152) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is methyl (2S)-2-[methyl-(2-nitrophenyl)sulfonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[methyl-(2-nitrophenyl)sulfonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 177407152 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | methyl (2S)-2-[methyl-(2-nitrophenyl)sulfonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(C)(C)C)cc1)N(C)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N2O7S/c1-21(2,3)30-16-12-10-15(11-13-16)14-18(20(24)29-5)22(4)31(27,28)19-9-7-6-8-17(19)23(25)26/h6-13,18H,14H2,1-5H3/t18-/m0/s1 |
| InChIKey | NIOIYQFSVJGSDQ-SFHVURJKSA-N |
| XLogP | 3.18 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|