C23H28N2O5S — CID 23649775
N-[(2R)-1-(4-methoxyphenyl)-3-methylbut-3-en-2-yl]-N-(3-methylbut-3-enyl)-2-nitrobenzenesulfonamide (PubChem CID 23649775) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[(2R)-1-(4-methoxyphenyl)-3-methylbut-3-en-2-yl]-N-(3-methylbut-3-enyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-1-(4-methoxyphenyl)-3-methylbut-3-en-2-yl]-N-(3-methylbut-3-enyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23649775 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[(2R)-1-(4-methoxyphenyl)-3-methylbut-3-en-2-yl]-N-(3-methylbut-3-enyl)-2-nitrobenzenesulfonamide |
| SMILES | C=C(C)CCN([C@H](Cc1ccc(OC)cc1)C(=C)C)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N2O5S/c1-17(2)14-15-24(31(28,29)23-9-7-6-8-21(23)25(26)27)22(18(3)4)16-19-10-12-20(30-5)13-11-19/h6-13,22H,1,3,14-16H2,2,4-5H3/t22-/m1/s1 |
| InChIKey | LUBVBJXDNVYIDZ-JOCHJYFZSA-N |
| XLogP | 4.75 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|