C12H15BrN2O6S — CID 20791936
methyl 2-[2-bromoethyl-(2-nitrophenyl)sulfonylamino]propanoate (PubChem CID 20791936) has the molecular formula C12H15BrN2O6S and a molecular weight of 395.23 g/mol. Its IUPAC name is methyl 2-[2-bromoethyl-(2-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-[2-bromoethyl-(2-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 20791936 |
| Molecular Formula | C12H15BrN2O6S |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | methyl 2-[2-bromoethyl-(2-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)N(CCBr)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15BrN2O6S/c1-9(12(16)21-2)14(8-7-13)22(19,20)11-6-4-3-5-10(11)15(17)18/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | DNXPORLBNGHUHA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|