C19H21BrN2O7S — CID 11733815
methyl (2R)-2-[2-bromoethyl-(2-nitro-4-phenylmethoxyphenyl)sulfonylamino]propanoate (PubChem CID 11733815) has the molecular formula C19H21BrN2O7S and a molecular weight of 501.36 g/mol. Its IUPAC name is methyl (2R)-2-[2-bromoethyl-(2-nitro-4-phenylmethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2R)-2-[2-bromoethyl-(2-nitro-4-phenylmethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 11733815 |
| Molecular Formula | C19H21BrN2O7S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | methyl (2R)-2-[2-bromoethyl-(2-nitro-4-phenylmethoxyphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](C)N(CCBr)S(=O)(=O)c1ccc(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21BrN2O7S/c1-14(19(23)28-2)21(11-10-20)30(26,27)18-9-8-16(12-17(18)22(24)25)29-13-15-6-4-3-5-7-15/h3-9,12,14H,10-11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | BCFGRDHNDVBUIW-CQSZACIVSA-N |
| XLogP | 3.12 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|