C34H32N2O12 — CID 161269575
methyl 2-hydroxy-3-(2-nitro-4-phenylmethoxyphenyl)propanoate;methyl 3-(2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoate (PubChem CID 161269575) has the molecular formula C34H32N2O12 and a molecular weight of 660.63 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(2-nitro-4-phenylmethoxyphenyl)propanoate;methyl 3-(2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoate.
| Compound Name | methyl 2-hydroxy-3-(2-nitro-4-phenylmethoxyphenyl)propanoate;methyl 3-(2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoate |
|---|---|
| PubChem CID | 161269575 |
| Molecular Formula | C34H32N2O12 |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | methyl 2-hydroxy-3-(2-nitro-4-phenylmethoxyphenyl)propanoate;methyl 3-(2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoate |
| SMILES | COC(=O)C(=O)Cc1ccc(OCc2ccccc2)cc1[N+](=O)[O-].COC(=O)C(O)Cc1ccc(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17NO6.C17H15NO6/c2*1-23-17(20)16(19)9-13-7-8-14(10-15(13)18(21)22)24-11-12-5-3-2-4-6-12/h2-8,10,16,19H,9,11H2,1H3;2-8,10H,9,11H2,1H3 |
| InChIKey | VDQFGDPESIGPGQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 194.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|