C14H20N4O7S — CID 142888674
methyl 2-[2-[amino-(2-nitrophenyl)sulfonylamino]butanoylamino]propanoate (PubChem CID 142888674) has the molecular formula C14H20N4O7S and a molecular weight of 388.40 g/mol. Its IUPAC name is methyl 2-[2-[amino-(2-nitrophenyl)sulfonylamino]butanoylamino]propanoate.
| Compound Name | methyl 2-[2-[amino-(2-nitrophenyl)sulfonylamino]butanoylamino]propanoate |
|---|---|
| PubChem CID | 142888674 |
| Molecular Formula | C14H20N4O7S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | methyl 2-[2-[amino-(2-nitrophenyl)sulfonylamino]butanoylamino]propanoate |
| SMILES | CCC(C(=O)NC(C)C(=O)OC)N(N)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O7S/c1-4-10(13(19)16-9(2)14(20)25-3)17(15)26(23,24)12-8-6-5-7-11(12)18(21)22/h5-10H,4,15H2,1-3H3,(H,16,19) |
| InChIKey | HSHFVCWQUMZGTR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|