C14H16N2O7S — CID 10665934
methyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonyl-prop-2-ynylamino]butanoate (PubChem CID 10665934) has the molecular formula C14H16N2O7S and a molecular weight of 356.36 g/mol. Its IUPAC name is methyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonyl-prop-2-ynylamino]butanoate.
| Compound Name | methyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonyl-prop-2-ynylamino]butanoate |
|---|---|
| PubChem CID | 10665934 |
| Molecular Formula | C14H16N2O7S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | methyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonyl-prop-2-ynylamino]butanoate |
| SMILES | C#CCN([C@@H](C(=O)OC)[C@@H](C)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O7S/c1-4-9-15(13(10(2)17)14(18)23-3)24(21,22)12-8-6-5-7-11(12)16(19)20/h1,5-8,10,13,17H,9H2,2-3H3/t10-,13-/m1/s1 |
| InChIKey | DEVNTZSBIDTCHZ-ZWNOBZJWSA-N |
| XLogP | 0.14 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|