C20H30N4O6S — CID 138628371
N-[(2S)-4,4-dimethyl-1-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-5-oxopentan-2-yl]acetamide (PubChem CID 138628371) has the molecular formula C20H30N4O6S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[(2S)-4,4-dimethyl-1-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-5-oxopentan-2-yl]acetamide.
| Compound Name | N-[(2S)-4,4-dimethyl-1-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-5-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 138628371 |
| Molecular Formula | C20H30N4O6S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[(2S)-4,4-dimethyl-1-[(3S)-3-methyl-4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-5-oxopentan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](CN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](C)C1)CC(C)(C)C=O |
| InChI | InChI=1S/C20H30N4O6S/c1-15-12-22(13-17(21-16(2)26)11-20(3,4)14-25)9-10-23(15)31(29,30)19-8-6-5-7-18(19)24(27)28/h5-8,14-15,17H,9-13H2,1-4H3,(H,21,26)/t15-,17-/m0/s1 |
| InChIKey | JTPUCOBHNBYWOY-RDJZCZTQSA-N |
| XLogP | 1.41 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|