C14H19N3O7S — CID 170562996
methyl 2-[5-(hydroxymethyl)-4-(2-nitrophenyl)sulfonylpiperazin-2-yl]acetate (PubChem CID 170562996) has the molecular formula C14H19N3O7S and a molecular weight of 373.39 g/mol. Its IUPAC name is methyl 2-[5-(hydroxymethyl)-4-(2-nitrophenyl)sulfonylpiperazin-2-yl]acetate.
| Compound Name | methyl 2-[5-(hydroxymethyl)-4-(2-nitrophenyl)sulfonylpiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 170562996 |
| Molecular Formula | C14H19N3O7S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | methyl 2-[5-(hydroxymethyl)-4-(2-nitrophenyl)sulfonylpiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C(CO)CN1 |
| InChI | InChI=1S/C14H19N3O7S/c1-24-14(19)6-10-8-16(11(9-18)7-15-10)25(22,23)13-5-3-2-4-12(13)17(20)21/h2-5,10-11,15,18H,6-9H2,1H3 |
| InChIKey | OKXBKZDSVHTCMO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|