C19H27N3O9S — CID 175498210
2-tert-butyl-5-(hydroxymethyl)-2-(2-methoxy-2-oxoethyl)-4-(2-nitrophenyl)sulfonylpiperazine-1-carboxylic acid (PubChem CID 175498210) has the molecular formula C19H27N3O9S and a molecular weight of 473.50 g/mol. Its IUPAC name is 2-tert-butyl-5-(hydroxymethyl)-2-(2-methoxy-2-oxoethyl)-4-(2-nitrophenyl)sulfonylpiperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-5-(hydroxymethyl)-2-(2-methoxy-2-oxoethyl)-4-(2-nitrophenyl)sulfonylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175498210 |
| Molecular Formula | C19H27N3O9S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-tert-butyl-5-(hydroxymethyl)-2-(2-methoxy-2-oxoethyl)-4-(2-nitrophenyl)sulfonylpiperazine-1-carboxylic acid |
| SMILES | COC(=O)CC1(C(C)(C)C)CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C(CO)CN1C(=O)O |
| InChI | InChI=1S/C19H27N3O9S/c1-18(2,3)19(9-16(24)31-4)12-21(13(11-23)10-20(19)17(25)26)32(29,30)15-8-6-5-7-14(15)22(27)28/h5-8,13,23H,9-12H2,1-4H3,(H,25,26) |
| InChIKey | IEWJJUOKPGPGKC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|