C17H22FN3O8S — CID 90004518
4-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonyl-(2-nitrophenyl)sulfonylamino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 90004518) has the molecular formula C17H22FN3O8S and a molecular weight of 447.44 g/mol. Its IUPAC name is 4-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonyl-(2-nitrophenyl)sulfonylamino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 4-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonyl-(2-nitrophenyl)sulfonylamino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90004518 |
| Molecular Formula | C17H22FN3O8S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonyl-(2-nitrophenyl)sulfonylamino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(CC1CC(F)CN1C(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22FN3O8S/c1-17(2,3)29-16(24)20(10-12-8-11(18)9-19(12)15(22)23)30(27,28)14-7-5-4-6-13(14)21(25)26/h4-7,11-12H,8-10H2,1-3H3,(H,22,23) |
| InChIKey | BYFOHNCERMNIIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|