C19H18N2O8S — CID 41114667
phenacyl (2S,4R)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 41114667) has the molecular formula C19H18N2O8S and a molecular weight of 434.43 g/mol. Its IUPAC name is phenacyl (2S,4R)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | phenacyl (2S,4R)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 41114667 |
| Molecular Formula | C19H18N2O8S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | phenacyl (2S,4R)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1C[C@@H](O)CN1S(=O)(=O)c1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H18N2O8S/c22-14-10-16(19(24)29-12-17(23)13-6-2-1-3-7-13)20(11-14)30(27,28)18-9-5-4-8-15(18)21(25)26/h1-9,14,16,22H,10-12H2/t14-,16+/m1/s1 |
| InChIKey | RCNVZZREUHJFNL-ZBFHGGJFSA-N |
| XLogP | 1.14 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|