C25H27N3O8S — CID 2426675
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2S,4S)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 2426675) has the molecular formula C25H27N3O8S and a molecular weight of 529.57 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2S,4S)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2S,4S)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2426675 |
| Molecular Formula | C25H27N3O8S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2S,4S)-4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CN1/C(=C\C(=O)COC(=O)[C@@H]2C[C@H](O)CN2S(=O)(=O)c2ccccc2[N+](=O)[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H27N3O8S/c1-25(2)18-8-4-5-9-19(18)26(3)23(25)13-17(30)15-36-24(31)21-12-16(29)14-27(21)37(34,35)22-11-7-6-10-20(22)28(32)33/h4-11,13,16,21,29H,12,14-15H2,1-3H3/b23-13-/t16-,21-/m0/s1 |
| InChIKey | ZNITWDSKDFRUSI-QKVAYCKHSA-N |
| XLogP | 2.14 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|