C18H17ClN4O8S — CID 42966853
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 42966853) has the molecular formula C18H17ClN4O8S and a molecular weight of 484.87 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42966853 |
| Molecular Formula | C18H17ClN4O8S |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxy-1-(2-nitrophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)C1CC(O)CN1S(=O)(=O)c1ccccc1[N+](=O)[O-])Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H17ClN4O8S/c19-11-5-6-16(20-8-11)21-17(25)10-31-18(26)14-7-12(24)9-22(14)32(29,30)15-4-2-1-3-13(15)23(27)28/h1-6,8,12,14,24H,7,9-10H2,(H,20,21,25) |
| InChIKey | ILVXUPAGXRMXFL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|