C21H22ClN3O9S — CID 97289162
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2S,4S)-1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 97289162) has the molecular formula C21H22ClN3O9S and a molecular weight of 527.94 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2S,4S)-1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2S,4S)-1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 97289162 |
| Molecular Formula | C21H22ClN3O9S |
| Molecular Weight | 527.94 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2S,4S)-1-(4-chlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)[C@@H]2C[C@H](O)CN2S(=O)(=O)c2ccc(Cl)cc2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H22ClN3O9S/c1-12-7-17(25(29)30)19(33-2)9-16(12)23-20(27)11-34-21(28)18-8-14(26)10-24(18)35(31,32)15-5-3-13(22)4-6-15/h3-7,9,14,18,26H,8,10-11H2,1-2H3,(H,23,27)/t14-,18-/m0/s1 |
| InChIKey | NDRUAGMGZINYJG-KSSFIOAISA-N |
| XLogP | 1.87 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.94 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|