C18H24N2O9S — CID 71723228
methyl 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(2-nitrophenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetate (PubChem CID 71723228) has the molecular formula C18H24N2O9S and a molecular weight of 444.46 g/mol. Its IUPAC name is methyl 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(2-nitrophenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetate.
| Compound Name | methyl 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(2-nitrophenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetate |
|---|---|
| PubChem CID | 71723228 |
| Molecular Formula | C18H24N2O9S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | methyl 2-[(3S,6aS,8S,10aS)-3-hydroxy-1-(2-nitrophenyl)sulfonyl-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocin-8-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC[C@H]2[C@@H](COC[C@@H](O)CN2S(=O)(=O)c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C18H24N2O9S/c1-27-18(22)8-13-6-7-14-16(29-13)11-28-10-12(21)9-19(14)30(25,26)17-5-3-2-4-15(17)20(23)24/h2-5,12-14,16,21H,6-11H2,1H3/t12-,13-,14-,16+/m0/s1 |
| InChIKey | ICMWYTCEVKHVBF-RZLSGREXSA-N |
| XLogP | 0.46 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|